About 2-(fluoromethyl)-1,5-dimethylpyridin-4-one
2-(fluoromethyl)-1,5-dimethylpyridin-4-one (PubChem CID 59818303) has the molecular formula C8H10FNO
and a molecular weight of 155.17 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,5-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-1,5-dimethylpyridin-4-one |
| PubChem CID | 59818303 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-(fluoromethyl)-1,5-dimethylpyridin-4-one |
| SMILES | Cc1cn(C)c(CF)cc1=O |
| InChI | InChI=1S/C8H10FNO/c1-6-5-10(2)7(4-9)3-8(6)11/h3,5H,4H2,1-2H3 |
| InChIKey | CCFJLVKEDHPFEA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(fluoromethyl)-1,5-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-1,5-dimethylpyridin-4-one?
The IUPAC name of 2-(fluoromethyl)-1,5-dimethylpyridin-4-one (CID 59818303) is 2-(fluoromethyl)-1,5-dimethylpyridin-4-one.
What is the SMILES notation for 2-(fluoromethyl)-1,5-dimethylpyridin-4-one?
The canonical SMILES for 2-(fluoromethyl)-1,5-dimethylpyridin-4-one is Cc1cn(C)c(CF)cc1=O.
What is the InChIKey of 2-(fluoromethyl)-1,5-dimethylpyridin-4-one?
The InChIKey is CCFJLVKEDHPFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO/c1-6-5-10(2)7(4-9)3-8(6)11/h3,5H,4H2,1-2H3.
What are the key properties of 2-(fluoromethyl)-1,5-dimethylpyridin-4-one?
2-(fluoromethyl)-1,5-dimethylpyridin-4-one has a molecular weight of 155.17 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-1,5-dimethylpyridin-4-one is sourced from PubChem (CID 59818303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).