C24H25N3O4S2 — CID 59818326
N-(3,3-diethoxypropyl)-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 59818326) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-(3,3-diethoxypropyl)-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59818326 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | CCOC(CCN(C(=O)c1cccs1)c1nc(-c2cc(-c3ccccc3)no2)cs1)OCC |
| InChI | InChI=1S/C24H25N3O4S2/c1-3-29-22(30-4-2)12-13-27(23(28)21-11-8-14-32-21)24-25-19(16-33-24)20-15-18(26-31-20)17-9-6-5-7-10-17/h5-11,14-16,22H,3-4,12-13H2,1-2H3 |
| InChIKey | LGDGGZPDLADASL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|