C27H32N2O4 — CID 59819552
[(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-pyridin-2-ylcarbamate (PubChem CID 59819552) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-pyridin-2-ylcarbamate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-pyridin-2-ylcarbamate |
|---|---|
| PubChem CID | 59819552 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl] N-pyridin-2-ylcarbamate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)CC[C@@]4(C)[C@@H]3[C@@H](OC(=O)Nc3ccccn3)C[C@]12C |
| InChI | InChI=1S/C27H32N2O4/c1-16(30)20-9-10-21-19-8-7-17-14-18(31)11-12-26(17,2)24(19)22(15-27(20,21)3)33-25(32)29-23-6-4-5-13-28-23/h4-8,13-14,19-22,24H,9-12,15H2,1-3H3,(H,28,29,32)/t19-,20+,21-,22-,24-,26+,27+/m0/s1 |
| InChIKey | CLZCFNJHZVSTKS-XBFZPGLGSA-N |
| XLogP | 5.12 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |