C34H31ClF3N7O3 — CID 59819639
1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide (PubChem CID 59819639) has the molecular formula C34H31ClF3N7O3 and a molecular weight of 678.12 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59819639 |
| Molecular Formula | C34H31ClF3N7O3 |
| Molecular Weight | 678.12 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-(4-chlorophenoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)n1c(-c2cccc(Oc3ccc(Cl)cc3)c2)nc2cc(C(=O)NCc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C34H31ClF3N7O3/c35-24-10-12-25(13-11-24)48-26-7-2-5-21(17-26)31-44-27-18-22(32(47)43-19-20-4-1-6-23(16-20)34(36,37)38)9-14-28(27)45(31)29(30(39)46)8-3-15-42-33(40)41/h1-2,4-7,9-14,16-18,29H,3,8,15,19H2,(H2,39,46)(H,43,47)(H4,40,41,42)/t29-/m0/s1 |
| InChIKey | QDZATOFMXOAIGV-LJAQVGFWSA-N |
| XLogP | 6.18 |
| TPSA | 163.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.12 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|