C39H41FN6O3 — CID 59819703
(2S)-5-(diaminomethylideneamino)-2-[5-[4-(4-fluorophenyl)cyclohexanecarbonyl]-2-[3-(2-methylphenoxy)phenyl]benzimidazol-1-yl]pentanamide (PubChem CID 59819703) has the molecular formula C39H41FN6O3 and a molecular weight of 660.79 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[5-[4-(4-fluorophenyl)cyclohexanecarbonyl]-2-[3-(2-methylphenoxy)phenyl]benzimidazol-1-yl]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[5-[4-(4-fluorophenyl)cyclohexanecarbonyl]-2-[3-(2-methylphenoxy)phenyl]benzimidazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 59819703 |
| Molecular Formula | C39H41FN6O3 |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[5-[4-(4-fluorophenyl)cyclohexanecarbonyl]-2-[3-(2-methylphenoxy)phenyl]benzimidazol-1-yl]pentanamide |
| SMILES | Cc1ccccc1Oc1cccc(-c2nc3cc(C(=O)C4CCC(c5ccc(F)cc5)CC4)ccc3n2[C@@H](CCCN=C(N)N)C(N)=O)c1 |
| InChI | InChI=1S/C39H41FN6O3/c1-24-6-2-3-10-35(24)49-31-8-4-7-29(22-31)38-45-32-23-28(17-20-33(32)46(38)34(37(41)48)9-5-21-44-39(42)43)36(47)27-13-11-25(12-14-27)26-15-18-30(40)19-16-26/h2-4,6-8,10,15-20,22-23,25,27,34H,5,9,11-14,21H2,1H3,(H2,41,48)(H4,42,43,44)/t25?,27?,34-/m0/s1 |
| InChIKey | UGGTUTFWNMMPKF-TZYCGWNQSA-N |
| XLogP | 7.18 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|