C28H29FN6O — CID 59819920
3-(3-azidopropyl)-8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 59819920) has the molecular formula C28H29FN6O and a molecular weight of 484.58 g/mol. Its IUPAC name is 3-(3-azidopropyl)-8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-(3-azidopropyl)-8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 59819920 |
| Molecular Formula | C28H29FN6O |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 3-(3-azidopropyl)-8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | [N-]=[N+]=NCCCN1CN(c2ccc(F)cc2)C2(CCN(C3Cc4cccc5cccc3c45)CC2)C1=O |
| InChI | InChI=1S/C28H29FN6O/c29-22-8-10-23(11-9-22)35-19-34(15-3-14-31-32-30)27(36)28(35)12-16-33(17-13-28)25-18-21-6-1-4-20-5-2-7-24(25)26(20)21/h1-2,4-11,25H,3,12-19H2 |
| InChIKey | PIAHGWWQSVPLMI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|