C31H31F3N2O3 — CID 59819991
ethyl 2-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylacetate (PubChem CID 59819991) has the molecular formula C31H31F3N2O3 and a molecular weight of 536.59 g/mol. Its IUPAC name is ethyl 2-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 59819991 |
| Molecular Formula | C31H31F3N2O3 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | ethyl 2-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1CCc2c([nH]c3ccc(OC)cc23)C1CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H31F3N2O3/c1-3-39-30(37)29(21-7-5-4-6-8-21)36-18-17-24-25-19-23(38-2)14-15-26(25)35-28(24)27(36)16-11-20-9-12-22(13-10-20)31(32,33)34/h4-10,12-15,19,27,29,35H,3,11,16-18H2,1-2H3 |
| InChIKey | YIPWEMPMQNBUES-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|