About 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine
7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine (PubChem CID 59820001) has the molecular formula C16H14F3NS
and a molecular weight of 309.36 g/mol. Its IUPAC name is 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine |
| PubChem CID | 59820001 |
| Molecular Formula | C16H14F3NS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine |
| SMILES | FC(F)(F)c1ccc(CCC2=NCCc3ccsc32)cc1 |
| InChI | InChI=1S/C16H14F3NS/c17-16(18,19)13-4-1-11(2-5-13)3-6-14-15-12(7-9-20-14)8-10-21-15/h1-2,4-5,8,10H,3,6-7,9H2 |
| InChIKey | JNEHBGAOSQLLNZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine?
The IUPAC name of 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine (CID 59820001) is 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine.
What is the SMILES notation for 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine?
The canonical SMILES for 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine is FC(F)(F)c1ccc(CCC2=NCCc3ccsc32)cc1.
What is the InChIKey of 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine?
The InChIKey is JNEHBGAOSQLLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NS/c17-16(18,19)13-4-1-11(2-5-13)3-6-14-15-12(7-9-20-14)8-10-21-15/h1-2,4-5,8,10H,3,6-7,9H2.
What are the key properties of 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine?
7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine has a molecular weight of 309.36 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[4-(trifluoromethyl)phenyl]ethyl]-4,5-dihydrothieno[2,3-c]pyridine is sourced from PubChem (CID 59820001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).