About N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide
N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide (PubChem CID 59820668) has the molecular formula C8H13N3O2S2
and a molecular weight of 247.34 g/mol. Its IUPAC name is N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide |
| PubChem CID | 59820668 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide |
| SMILES | CN(c1c2c(nn1C)CSC2)S(C)(=O)=O |
| InChI | InChI=1S/C8H13N3O2S2/c1-10-8(11(2)15(3,12)13)6-4-14-5-7(6)9-10/h4-5H2,1-3H3 |
| InChIKey | YWVFBYSLMGDZLD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide?
The IUPAC name of N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide (CID 59820668) is N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide.
What is the SMILES notation for N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide?
The canonical SMILES for N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide is CN(c1c2c(nn1C)CSC2)S(C)(=O)=O.
What is the InChIKey of N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide?
The InChIKey is YWVFBYSLMGDZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S2/c1-10-8(11(2)15(3,12)13)6-4-14-5-7(6)9-10/h4-5H2,1-3H3.
What are the key properties of N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide?
N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide has a molecular weight of 247.34 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)methanesulfonamide is sourced from PubChem (CID 59820668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).