C23H20F3N5O2S — CID 59821050
5-[6-(2-amino-2-iminoethyl)benzimidazol-1-yl]-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxamide (PubChem CID 59821050) has the molecular formula C23H20F3N5O2S and a molecular weight of 487.51 g/mol. Its IUPAC name is 5-[6-(2-amino-2-iminoethyl)benzimidazol-1-yl]-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxamide.
| Compound Name | 5-[6-(2-amino-2-iminoethyl)benzimidazol-1-yl]-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59821050 |
| Molecular Formula | C23H20F3N5O2S |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 5-[6-(2-amino-2-iminoethyl)benzimidazol-1-yl]-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxamide |
| SMILES | [H]/N=C(\N)Cc1ccc2ncn(-c3cc(O[C@H](C)c4ccccc4C(F)(F)F)c(C(N)=O)s3)c2c1 |
| InChI | InChI=1S/C23H20F3N5O2S/c1-12(14-4-2-3-5-15(14)23(24,25)26)33-18-10-20(34-21(18)22(29)32)31-11-30-16-7-6-13(8-17(16)31)9-19(27)28/h2-8,10-12H,9H2,1H3,(H3,27,28)(H2,29,32)/t12-/m1/s1 |
| InChIKey | JISXJBXANIROGI-GFCCVEGCSA-N |
| XLogP | 4.82 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|