About [(4S)-4,6-dimethyloxan-2-yl]methanol
[(4S)-4,6-dimethyloxan-2-yl]methanol (PubChem CID 59821303) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is [(4S)-4,6-dimethyloxan-2-yl]methanol.
Molecular Properties
| Compound Name | [(4S)-4,6-dimethyloxan-2-yl]methanol |
| PubChem CID | 59821303 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | [(4S)-4,6-dimethyloxan-2-yl]methanol |
| SMILES | CC1C[C@H](C)CC(CO)O1 |
| InChI | InChI=1S/C8H16O2/c1-6-3-7(2)10-8(4-6)5-9/h6-9H,3-5H2,1-2H3/t6-,7?,8?/m0/s1 |
| InChIKey | IULZLLQIGGHIDO-KKMMWDRVSA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4S)-4,6-dimethyloxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4,6-dimethyloxan-2-yl]methanol?
The IUPAC name of [(4S)-4,6-dimethyloxan-2-yl]methanol (CID 59821303) is [(4S)-4,6-dimethyloxan-2-yl]methanol.
What is the SMILES notation for [(4S)-4,6-dimethyloxan-2-yl]methanol?
The canonical SMILES for [(4S)-4,6-dimethyloxan-2-yl]methanol is CC1C[C@H](C)CC(CO)O1.
What is the InChIKey of [(4S)-4,6-dimethyloxan-2-yl]methanol?
The InChIKey is IULZLLQIGGHIDO-KKMMWDRVSA-N. The full InChI is InChI=1S/C8H16O2/c1-6-3-7(2)10-8(4-6)5-9/h6-9H,3-5H2,1-2H3/t6-,7?,8?/m0/s1.
What are the key properties of [(4S)-4,6-dimethyloxan-2-yl]methanol?
[(4S)-4,6-dimethyloxan-2-yl]methanol has a molecular weight of 144.21 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4,6-dimethyloxan-2-yl]methanol is sourced from PubChem (CID 59821303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).