C29H29N3O2 — CID 59821336
1-(4,4-dimethylpentyl)-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 59821336) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-(4,4-dimethylpentyl)-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 59821336 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC(C)(C)CCCC12c3ccccc3C(c3ccccc31)n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C29H29N3O2/c1-28(2,3)18-11-19-29-23-16-9-7-14-21(23)25(22-15-8-10-17-24(22)29)31-26(33)30(27(34)32(29)31)20-12-5-4-6-13-20/h4-10,12-17,25H,11,18-19H2,1-3H3 |
| InChIKey | LDOPSUJMDFOPBP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |