About 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene
1,4-bis(4-methylphenyl)-2,5-dipropylbenzene (PubChem CID 59821666) has the molecular formula C26H30
and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene.
Molecular Properties
| Compound Name | 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene |
| PubChem CID | 59821666 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene |
| SMILES | CCCc1cc(-c2ccc(C)cc2)c(CCC)cc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H30/c1-5-7-23-17-26(22-15-11-20(4)12-16-22)24(8-6-2)18-25(23)21-13-9-19(3)10-14-21/h9-18H,5-8H2,1-4H3 |
| InChIKey | VJGAIDAORFCMJM-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene?
The IUPAC name of 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene (CID 59821666) is 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene.
What is the SMILES notation for 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene?
The canonical SMILES for 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene is CCCc1cc(-c2ccc(C)cc2)c(CCC)cc1-c1ccc(C)cc1.
What is the InChIKey of 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene?
The InChIKey is VJGAIDAORFCMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30/c1-5-7-23-17-26(22-15-11-20(4)12-16-22)24(8-6-2)18-25(23)21-13-9-19(3)10-14-21/h9-18H,5-8H2,1-4H3.
What are the key properties of 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene?
1,4-bis(4-methylphenyl)-2,5-dipropylbenzene has a molecular weight of 342.53 g/mol, XLogP of 7.54, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-methylphenyl)-2,5-dipropylbenzene is sourced from PubChem (CID 59821666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).