About (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate
(2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate (PubChem CID 59821789) has the molecular formula C15H18N2O4S
and a molecular weight of 322.39 g/mol. Its IUPAC name is (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate |
| PubChem CID | 59821789 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(S(C)(=O)=O)c(C)c2C)n(C)n1 |
| InChI | InChI=1S/C15H18N2O4S/c1-9-8-14(17(4)16-9)21-15(18)12-6-7-13(22(5,19)20)11(3)10(12)2/h6-8H,1-5H3 |
| InChIKey | OTIPUBVFMSIWPM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate?
The IUPAC name of (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate (CID 59821789) is (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate.
What is the SMILES notation for (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate?
The canonical SMILES for (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate is Cc1cc(OC(=O)c2ccc(S(C)(=O)=O)c(C)c2C)n(C)n1.
What is the InChIKey of (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate?
The InChIKey is OTIPUBVFMSIWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4S/c1-9-8-14(17(4)16-9)21-15(18)12-6-7-13(22(5,19)20)11(3)10(12)2/h6-8H,1-5H3.
What are the key properties of (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate?
(2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate has a molecular weight of 322.39 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylpyrazol-3-yl) 2,3-dimethyl-4-methylsulfonylbenzoate is sourced from PubChem (CID 59821789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).