C28H33N3O4Si — CID 59822141
4-[7-[3-(3-hydroxypropyl)phenyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]benzoic acid (PubChem CID 59822141) has the molecular formula C28H33N3O4Si and a molecular weight of 503.68 g/mol. Its IUPAC name is 4-[7-[3-(3-hydroxypropyl)phenyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]benzoic acid.
| Compound Name | 4-[7-[3-(3-hydroxypropyl)phenyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 59822141 |
| Molecular Formula | C28H33N3O4Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 4-[7-[3-(3-hydroxypropyl)phenyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(C(=O)O)cc2)nc2c(-c3cccc(CCCO)c3)ccnc21 |
| InChI | InChI=1S/C28H33N3O4Si/c1-36(2,3)17-16-35-19-31-26(21-9-11-22(12-10-21)28(33)34)30-25-24(13-14-29-27(25)31)23-8-4-6-20(18-23)7-5-15-32/h4,6,8-14,18,32H,5,7,15-17,19H2,1-3H3,(H,33,34) |
| InChIKey | HZZDDVDYASKIHO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|