C27H35N7O2 — CID 59822457
N-[6-[2-(3,5-dimethoxyanilino)benzimidazol-1-yl]pyrimidin-4-yl]-N',N'-diethylbutane-1,4-diamine (PubChem CID 59822457) has the molecular formula C27H35N7O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[6-[2-(3,5-dimethoxyanilino)benzimidazol-1-yl]pyrimidin-4-yl]-N',N'-diethylbutane-1,4-diamine.
| Compound Name | N-[6-[2-(3,5-dimethoxyanilino)benzimidazol-1-yl]pyrimidin-4-yl]-N',N'-diethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 59822457 |
| Molecular Formula | C27H35N7O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | N-[6-[2-(3,5-dimethoxyanilino)benzimidazol-1-yl]pyrimidin-4-yl]-N',N'-diethylbutane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1cc(-n2c(Nc3cc(OC)cc(OC)c3)nc3ccccc32)ncn1 |
| InChI | InChI=1S/C27H35N7O2/c1-5-33(6-2)14-10-9-13-28-25-18-26(30-19-29-25)34-24-12-8-7-11-23(24)32-27(34)31-20-15-21(35-3)17-22(16-20)36-4/h7-8,11-12,15-19H,5-6,9-10,13-14H2,1-4H3,(H,31,32)(H,28,29,30) |
| InChIKey | GEKLZUXBPFKQGQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|