About (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten
(6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten (PubChem CID 59822820) has the molecular formula C7H5O2W-
and a molecular weight of 304.96 g/mol. Its IUPAC name is (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten.
Molecular Properties
| Compound Name | (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten |
| PubChem CID | 59822820 |
| Molecular Formula | C7H5O2W- |
| Molecular Weight | 304.96 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten |
| SMILES | O=C1C=C[C-]=C/C1=C/O.[W] |
| InChI | InChI=1S/C7H5O2.W/c8-5-6-3-1-2-4-7(6)9;/h2-5,8H;/q-1;/b6-5-; |
| InChIKey | JEDMCLZTQBDBRA-YSMBQZINSA-N |
| XLogP | 0.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.96 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten?
The IUPAC name of (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten (CID 59822820) is (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten.
What is the SMILES notation for (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten?
The canonical SMILES for (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten is O=C1C=C[C-]=C/C1=C/O.[W].
What is the InChIKey of (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten?
The InChIKey is JEDMCLZTQBDBRA-YSMBQZINSA-N. The full InChI is InChI=1S/C7H5O2.W/c8-5-6-3-1-2-4-7(6)9;/h2-5,8H;/q-1;/b6-5-;.
What are the key properties of (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten?
(6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten has a molecular weight of 304.96 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-one;tungsten is sourced from PubChem (CID 59822820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).