About 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate
1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate (PubChem CID 59823407) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate.
Molecular Properties
| Compound Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate |
| PubChem CID | 59823407 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate |
| SMILES | CCC(=O)OC1C2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C12H19NO2/c1-2-11(14)15-12-9-3-8-4-10(12)7-13(5-8)6-9/h8-10,12H,2-7H2,1H3 |
| InChIKey | WNPWCKWMDOAKLH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate?
The IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate (CID 59823407) is 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate.
What is the SMILES notation for 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate?
The canonical SMILES for 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate is CCC(=O)OC1C2CC3CC1CN(C3)C2.
What is the InChIKey of 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate?
The InChIKey is WNPWCKWMDOAKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-2-11(14)15-12-9-3-8-4-10(12)7-13(5-8)6-9/h8-10,12H,2-7H2,1H3.
What are the key properties of 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate?
1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate has a molecular weight of 209.29 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[3.3.1.13,7]decan-4-yl propanoate is sourced from PubChem (CID 59823407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).