C19H18N4O2S — CID 59823582
1,4,6,7-tetradeuterio-2-[dideuterio-(5,6-dideuterio-4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl-5-(2,3,4,5-tetradeuteriopyrrol-1-yl)benzimidazole (PubChem CID 59823582) has the molecular formula C19H18N4O2S and a molecular weight of 378.52 g/mol. Its IUPAC name is 1,4,6,7-tetradeuterio-2-[dideuterio-(5,6-dideuterio-4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl-5-(2,3,4,5-tetradeuteriopyrrol-1-yl)benzimidazole.
| Compound Name | 1,4,6,7-tetradeuterio-2-[dideuterio-(5,6-dideuterio-4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl-5-(2,3,4,5-tetradeuteriopyrrol-1-yl)benzimidazole |
|---|---|
| PubChem CID | 59823582 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,4,6,7-tetradeuterio-2-[dideuterio-(5,6-dideuterio-4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl-5-(2,3,4,5-tetradeuteriopyrrol-1-yl)benzimidazole |
| SMILES | [2H]c1nc(C([2H])([2H])S(=O)c2nc3c([2H])c(-n4c([2H])c([2H])c([2H])c4[2H])c([2H])c([2H])c3n2[2H])c(C)c(OC)c1[2H] |
| InChI | InChI=1S/C19H18N4O2S/c1-13-17(20-8-7-18(13)25-2)12-26(24)19-21-15-6-5-14(11-16(15)22-19)23-9-3-4-10-23/h3-11H,12H2,1-2H3,(H,21,22)/i3D,4D,5D,6D,7D,8D,9D,10D,11D,12D2/hD |
| InChIKey | HRRXCXABAPSOCP-JWGBOXDNSA-N |
| XLogP | 3.37 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |