C25H24N4O6S — CID 59823763
2-[4-[[furan-2-ylmethyl-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]amino]methyl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 59823763) has the molecular formula C25H24N4O6S and a molecular weight of 508.56 g/mol. Its IUPAC name is 2-[4-[[furan-2-ylmethyl-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]amino]methyl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[[furan-2-ylmethyl-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]amino]methyl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59823763 |
| Molecular Formula | C25H24N4O6S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[4-[[furan-2-ylmethyl-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]amino]methyl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1ccc(CN(Cc2ccco2)Cc2nc(-c3ccc([N+](=O)[O-])cc3)no2)cc1)C(=O)O |
| InChI | InChI=1S/C25H24N4O6S/c1-25(2,24(30)31)36-21-11-5-17(6-12-21)14-28(15-20-4-3-13-34-20)16-22-26-23(27-35-22)18-7-9-19(10-8-18)29(32)33/h3-13H,14-16H2,1-2H3,(H,30,31) |
| InChIKey | RQFNTBQSCSBYIB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|