C19H27FN4 — CID 59823894
1-cyano-2-(2-fluoroethyl)-3-[5-(3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-1-yl]guanidine (PubChem CID 59823894) has the molecular formula C19H27FN4 and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-cyano-2-(2-fluoroethyl)-3-[5-(3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-1-yl]guanidine.
| Compound Name | 1-cyano-2-(2-fluoroethyl)-3-[5-(3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-1-yl]guanidine |
|---|---|
| PubChem CID | 59823894 |
| Molecular Formula | C19H27FN4 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-cyano-2-(2-fluoroethyl)-3-[5-(3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-1-yl]guanidine |
| SMILES | CC(C)CCc1cccc2c1CCCC2N/C(=N/CCF)NC#N |
| InChI | InChI=1S/C19H27FN4/c1-14(2)9-10-15-5-3-7-17-16(15)6-4-8-18(17)24-19(23-13-21)22-12-11-20/h3,5,7,14,18H,4,6,8-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | VSVCLTJGHXPEOG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|