C10H20O — CID 59823957
(3S,6S)-2,3,4,5,6-pentamethyloxane (PubChem CID 59823957) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (3S,6S)-2,3,4,5,6-pentamethyloxane.
| Compound Name | (3S,6S)-2,3,4,5,6-pentamethyloxane |
|---|---|
| PubChem CID | 59823957 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (3S,6S)-2,3,4,5,6-pentamethyloxane |
| SMILES | CC1O[C@@H](C)C(C)C(C)[C@@H]1C |
| InChI | InChI=1S/C10H20O/c1-6-7(2)9(4)11-10(5)8(6)3/h6-10H,1-5H3/t6?,7-,8?,9?,10-/m0/s1 |
| InChIKey | DLENZAYIWZDJFK-LDNHNQRNSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |