C24H32BN3O2 — CID 59824133
N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 59824133) has the molecular formula C24H32BN3O2 and a molecular weight of 405.35 g/mol. Its IUPAC name is N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 59824133 |
| Molecular Formula | C24H32BN3O2 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1cccc(C)c1CNc1cc(B2OC(C)(C)C(C)(C)O2)cn2c(C)c(C)nc12 |
| InChI | InChI=1S/C24H32BN3O2/c1-15-10-9-11-16(2)20(15)13-26-21-12-19(14-28-18(4)17(3)27-22(21)28)25-29-23(5,6)24(7,8)30-25/h9-12,14,26H,13H2,1-8H3 |
| InChIKey | YPJPICCGBNMEEI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|