About 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium
3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium (PubChem CID 59824605) has the molecular formula C14H30NO3+
and a molecular weight of 260.40 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium.
Molecular Properties
| Compound Name | 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium |
| PubChem CID | 59824605 |
| Molecular Formula | C14H30NO3+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium |
| SMILES | CCC(C)(C)C(=O)OCCC[N+](C)(C)CCOC |
| InChI | InChI=1S/C14H30NO3/c1-7-14(2,3)13(16)18-11-8-9-15(4,5)10-12-17-6/h7-12H2,1-6H3/q+1 |
| InChIKey | XMJOXKIJZMEEJA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium?
The IUPAC name of 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium (CID 59824605) is 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium.
What is the SMILES notation for 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium?
The canonical SMILES for 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium is CCC(C)(C)C(=O)OCCC[N+](C)(C)CCOC.
What is the InChIKey of 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium?
The InChIKey is XMJOXKIJZMEEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30NO3/c1-7-14(2,3)13(16)18-11-8-9-15(4,5)10-12-17-6/h7-12H2,1-6H3/q+1.
What are the key properties of 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium?
3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium has a molecular weight of 260.40 g/mol, XLogP of 2.08, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylbutanoyloxy)propyl-(2-methoxyethyl)-dimethylazanium is sourced from PubChem (CID 59824605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).