About CID 59824719
CID 59824719 (PubChem CID 59824719) has the molecular formula C7H11O3
and a molecular weight of 143.16 g/mol.
Molecular Properties
| Compound Name | CID 59824719 |
| PubChem CID | 59824719 |
| Molecular Formula | C7H11O3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | — |
| SMILES | OCC1C=C[CH]C(O)C1O |
| InChI | InChI=1S/C7H11O3/c8-4-5-2-1-3-6(9)7(5)10/h1-3,5-10H,4H2 |
| InChIKey | AITWHPCZDIVJKM-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59824719 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59824719?
The IUPAC name of CID 59824719 (CID 59824719) is not available.
What is the SMILES notation for CID 59824719?
The canonical SMILES for CID 59824719 is OCC1C=C[CH]C(O)C1O.
What is the InChIKey of CID 59824719?
The InChIKey is AITWHPCZDIVJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O3/c8-4-5-2-1-3-6(9)7(5)10/h1-3,5-10H,4H2.
What are the key properties of CID 59824719?
CID 59824719 has a molecular weight of 143.16 g/mol, XLogP of -0.91, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59824719 is sourced from PubChem (CID 59824719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).