About (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine
(4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59824833) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 59824833 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@H](CCc2ccccc2)CO1 |
| InChI | InChI=1S/C11H14N2O/c12-11-13-10(8-14-11)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,12,13)/t10-/m0/s1 |
| InChIKey | RWFKAYWCTYRPQU-JTQLQIEISA-N |
| XLogP | 1.33 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine (CID 59824833) is (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine is NC1=N[C@@H](CCc2ccccc2)CO1.
What is the InChIKey of (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is RWFKAYWCTYRPQU-JTQLQIEISA-N. The full InChI is InChI=1S/C11H14N2O/c12-11-13-10(8-14-11)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,12,13)/t10-/m0/s1.
What are the key properties of (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine?
(4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 190.25 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 59824833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).