C22H30N4O3Si — CID 59824844
2-hydroxy-N,N-dimethyl-2-[5-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]acetamide (PubChem CID 59824844) has the molecular formula C22H30N4O3Si and a molecular weight of 426.59 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-2-[5-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]acetamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-2-[5-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59824844 |
| Molecular Formula | C22H30N4O3Si |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-2-[5-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]acetamide |
| SMILES | CN(C)C(=O)C(O)c1cncc(-c2cnc3c(ccn3COCC[Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H30N4O3Si/c1-25(2)22(28)20(27)19-11-17(12-23-13-19)18-10-16-6-7-26(21(16)24-14-18)15-29-8-9-30(3,4)5/h6-7,10-14,20,27H,8-9,15H2,1-5H3 |
| InChIKey | VTHPAHOLDJJFFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|