C30H38N4O3Si — CID 59824913
2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide (PubChem CID 59824913) has the molecular formula C30H38N4O3Si and a molecular weight of 530.75 g/mol. Its IUPAC name is 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 59824913 |
| Molecular Formula | C30H38N4O3Si |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethylpropanamide |
| SMILES | COc1ccccc1-c1nn(COCC[Si](C)(C)C)c2ncc(-c3cccc(C(C)C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C30H38N4O3Si/c1-21(30(35)33(2)3)22-11-10-12-23(17-22)24-18-26-28(25-13-8-9-14-27(25)36-4)32-34(29(26)31-19-24)20-37-15-16-38(5,6)7/h8-14,17-19,21H,15-16,20H2,1-7H3 |
| InChIKey | VUQKYRZOCQZBME-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|