C29H34N4O4Si — CID 59824982
2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 59824982) has the molecular formula C29H34N4O4Si and a molecular weight of 530.70 g/mol. Its IUPAC name is 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 59824982 |
| Molecular Formula | C29H34N4O4Si |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 2-[3-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | COc1ccccc1-c1nn(COCC[Si](C)(C)C)c2ncc(-c3cccc(C(=O)C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C29H34N4O4Si/c1-32(2)29(35)27(34)21-11-9-10-20(16-21)22-17-24-26(23-12-7-8-13-25(23)36-3)31-33(28(24)30-18-22)19-37-14-15-38(4,5)6/h7-13,16-18H,14-15,19H2,1-6H3 |
| InChIKey | XPGMZSNCRAOALI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|