C28H35N5O4Si — CID 59824997
2-hydroxy-2-[5-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]-3-pyridinyl]-N,N-dimethylacetamide (PubChem CID 59824997) has the molecular formula C28H35N5O4Si and a molecular weight of 533.71 g/mol. Its IUPAC name is 2-hydroxy-2-[5-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]-3-pyridinyl]-N,N-dimethylacetamide.
| Compound Name | 2-hydroxy-2-[5-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]-3-pyridinyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 59824997 |
| Molecular Formula | C28H35N5O4Si |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 2-hydroxy-2-[5-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]-3-pyridinyl]-N,N-dimethylacetamide |
| SMILES | COc1ccccc1-c1nn(COCC[Si](C)(C)C)c2ncc(-c3cncc(C(O)C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C28H35N5O4Si/c1-32(2)28(35)26(34)21-13-19(15-29-16-21)20-14-23-25(22-9-7-8-10-24(22)36-3)31-33(27(23)30-17-20)18-37-11-12-38(4,5)6/h7-10,13-17,26,34H,11-12,18H2,1-6H3 |
| InChIKey | FXHHABCJPIYHMT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|