C28H34FN5O3Si — CID 59825057
2-[2-amino-5-[3-(2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide (PubChem CID 59825057) has the molecular formula C28H34FN5O3Si and a molecular weight of 535.70 g/mol. Its IUPAC name is 2-[2-amino-5-[3-(2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide.
| Compound Name | 2-[2-amino-5-[3-(2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 59825057 |
| Molecular Formula | C28H34FN5O3Si |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 2-[2-amino-5-[3-(2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(O)c1cc(-c2cnc3c(c2)c(-c2ccccc2F)cn3COCC[Si](C)(C)C)cnc1N |
| InChI | InChI=1S/C28H34FN5O3Si/c1-33(2)28(36)25(35)22-13-19(14-31-26(22)30)18-12-21-23(20-8-6-7-9-24(20)29)16-34(27(21)32-15-18)17-37-10-11-38(3,4)5/h6-9,12-16,25,35H,10-11,17H2,1-5H3,(H2,30,31) |
| InChIKey | HPQLLXUESYFJRV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|