About (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate
(2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate (PubChem CID 59825489) has the molecular formula C15H20BrNO2
and a molecular weight of 326.23 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate |
| PubChem CID | 59825489 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CC(C)CC(C)C2)c(Br)c1 |
| InChI | InChI=1S/C15H20BrNO2/c1-10-4-5-14(13(16)7-10)19-15(18)17-8-11(2)6-12(3)9-17/h4-5,7,11-12H,6,8-9H2,1-3H3 |
| InChIKey | LUYJCPZBTZXNEY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate?
The IUPAC name of (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate (CID 59825489) is (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate.
What is the SMILES notation for (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate?
The canonical SMILES for (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate is Cc1ccc(OC(=O)N2CC(C)CC(C)C2)c(Br)c1.
What is the InChIKey of (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate?
The InChIKey is LUYJCPZBTZXNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO2/c1-10-4-5-14(13(16)7-10)19-15(18)17-8-11(2)6-12(3)9-17/h4-5,7,11-12H,6,8-9H2,1-3H3.
What are the key properties of (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate?
(2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate has a molecular weight of 326.23 g/mol, XLogP of 4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methylphenyl) 3,5-dimethylpiperidine-1-carboxylate is sourced from PubChem (CID 59825489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).