C17H19ClN2O2 — CID 59825557
(4-chloroisoquinolin-3-yl) 3,5-dimethylpiperidine-1-carboxylate (PubChem CID 59825557) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (4-chloroisoquinolin-3-yl) 3,5-dimethylpiperidine-1-carboxylate.
| Compound Name | (4-chloroisoquinolin-3-yl) 3,5-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59825557 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (4-chloroisoquinolin-3-yl) 3,5-dimethylpiperidine-1-carboxylate |
| SMILES | CC1CC(C)CN(C(=O)Oc2ncc3ccccc3c2Cl)C1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-11-7-12(2)10-20(9-11)17(21)22-16-15(18)14-6-4-3-5-13(14)8-19-16/h3-6,8,11-12H,7,9-10H2,1-2H3 |
| InChIKey | OFPROZGOFRIQHI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |