C37H50FN3O5 — CID 59825601
(8aR)-4-(3,4-dimethoxyphenyl)-2-[5-[2-[5-[3-(2-fluoro-5-methoxyphenyl)propyl]oxolan-2-yl]ethylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 59825601) has the molecular formula C37H50FN3O5 and a molecular weight of 635.82 g/mol. Its IUPAC name is (8aR)-4-(3,4-dimethoxyphenyl)-2-[5-[2-[5-[3-(2-fluoro-5-methoxyphenyl)propyl]oxolan-2-yl]ethylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (8aR)-4-(3,4-dimethoxyphenyl)-2-[5-[2-[5-[3-(2-fluoro-5-methoxyphenyl)propyl]oxolan-2-yl]ethylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 59825601 |
| Molecular Formula | C37H50FN3O5 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.37 |
| IUPAC Name | (8aR)-4-(3,4-dimethoxyphenyl)-2-[5-[2-[5-[3-(2-fluoro-5-methoxyphenyl)propyl]oxolan-2-yl]ethylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(F)c(CCCC2CCC(CCNCCCCCN3N=C(c4ccc(OC)c(OC)c4)C4CC=CC[C@H]4C3=O)O2)c1 |
| InChI | InChI=1S/C37H50FN3O5/c1-43-30-17-18-33(38)26(24-30)10-9-11-28-15-16-29(46-28)20-22-39-21-7-4-8-23-41-37(42)32-13-6-5-12-31(32)36(40-41)27-14-19-34(44-2)35(25-27)45-3/h5-6,14,17-19,24-25,28-29,31-32,39H,4,7-13,15-16,20-23H2,1-3H3/t28?,29?,31?,32-/m1/s1 |
| InChIKey | ILYANWOXFYOOPX-NXOXPMEMSA-N |
| XLogP | 6.70 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|