About 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one
1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one (PubChem CID 59825851) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one.
Molecular Properties
| Compound Name | 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one |
| PubChem CID | 59825851 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one |
| SMILES | CC(C)(C)c1ncn2c1CNC(=O)C2 |
| InChI | InChI=1S/C10H15N3O/c1-10(2,3)9-7-4-11-8(14)5-13(7)6-12-9/h6H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | DNKHJEFTIBGODR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one?
The IUPAC name of 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one (CID 59825851) is 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one.
What is the SMILES notation for 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one?
The canonical SMILES for 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one is CC(C)(C)c1ncn2c1CNC(=O)C2.
What is the InChIKey of 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one?
The InChIKey is DNKHJEFTIBGODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-10(2,3)9-7-4-11-8(14)5-13(7)6-12-9/h6H,4-5H2,1-3H3,(H,11,14).
What are the key properties of 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one?
1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one has a molecular weight of 193.25 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one is sourced from PubChem (CID 59825851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).