About N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide
N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide (PubChem CID 59826079) has the molecular formula C25H27N3O2S
and a molecular weight of 433.58 g/mol. Its IUPAC name is N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide |
| PubChem CID | 59826079 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(N2CC3CC2CN3)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H27N3O2S/c29-31(30,25-13-7-12-23(15-25)28-19-22-14-24(28)16-26-22)27(17-20-8-3-1-4-9-20)18-21-10-5-2-6-11-21/h1-13,15,22,24,26H,14,16-19H2 |
| InChIKey | HKTIRUWPGXDOER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide?
The IUPAC name of N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide (CID 59826079) is N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide.
What is the SMILES notation for N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide?
The canonical SMILES for N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide is O=S(=O)(c1cccc(N2CC3CC2CN3)c1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide?
The InChIKey is HKTIRUWPGXDOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O2S/c29-31(30,25-13-7-12-23(15-25)28-19-22-14-24(28)16-26-22)27(17-20-8-3-1-4-9-20)18-21-10-5-2-6-11-21/h1-13,15,22,24,26H,14,16-19H2.
What are the key properties of N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide?
N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide has a molecular weight of 433.58 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-3-(2,5-diazabicyclo[2.2.1]heptan-2-yl)benzenesulfonamide is sourced from PubChem (CID 59826079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).