About 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine
7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine (PubChem CID 59826295) has the molecular formula C19H24N4O2S
and a molecular weight of 372.49 g/mol. Its IUPAC name is 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine.
Molecular Properties
| Compound Name | 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine |
| PubChem CID | 59826295 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine |
| SMILES | O=S(=O)(c1ccc(CN2CCNCC2)cc1)N1CCc2cccnc2C1 |
| InChI | InChI=1S/C19H24N4O2S/c24-26(25,23-11-7-17-2-1-8-21-19(17)15-23)18-5-3-16(4-6-18)14-22-12-9-20-10-13-22/h1-6,8,20H,7,9-15H2 |
| InChIKey | CGKRTXLKMLZISJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine?
The IUPAC name of 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine (CID 59826295) is 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine.
What is the SMILES notation for 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine?
The canonical SMILES for 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine is O=S(=O)(c1ccc(CN2CCNCC2)cc1)N1CCc2cccnc2C1.
What is the InChIKey of 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine?
The InChIKey is CGKRTXLKMLZISJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O2S/c24-26(25,23-11-7-17-2-1-8-21-19(17)15-23)18-5-3-16(4-6-18)14-22-12-9-20-10-13-22/h1-6,8,20H,7,9-15H2.
What are the key properties of 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine?
7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine has a molecular weight of 372.49 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(piperazin-1-ylmethyl)phenyl]sulfonyl-6,8-dihydro-5H-1,7-naphthyridine is sourced from PubChem (CID 59826295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).