About N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide
N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 59826536) has the molecular formula C24H20ClN3O3
and a molecular weight of 433.90 g/mol. Its IUPAC name is N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide |
| PubChem CID | 59826536 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(Cl)c(-c3cnc4cccc(C)c4n3)c2)c1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-14-5-4-6-21-23(14)28-22(13-26-21)19-11-16(7-8-20(19)25)27-24(29)15-9-17(30-2)12-18(10-15)31-3/h4-13H,1-3H3,(H,27,29) |
| InChIKey | RIFXANDWJQXHOH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide?
The IUPAC name of N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide (CID 59826536) is N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide.
What is the SMILES notation for N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide?
The canonical SMILES for N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide is COc1cc(OC)cc(C(=O)Nc2ccc(Cl)c(-c3cnc4cccc(C)c4n3)c2)c1.
What is the InChIKey of N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide?
The InChIKey is RIFXANDWJQXHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClN3O3/c1-14-5-4-6-21-23(14)28-22(13-26-21)19-11-16(7-8-20(19)25)27-24(29)15-9-17(30-2)12-18(10-15)31-3/h4-13H,1-3H3,(H,27,29).
What are the key properties of N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide?
N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide has a molecular weight of 433.90 g/mol, XLogP of 5.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-chloro-3-(8-methylquinoxalin-2-yl)phenyl]-3,5-dimethoxybenzamide is sourced from PubChem (CID 59826536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).