C27H25ClN4O4S — CID 59826588
N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 59826588) has the molecular formula C27H25ClN4O4S and a molecular weight of 537.04 g/mol. Its IUPAC name is N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 59826588 |
| Molecular Formula | C27H25ClN4O4S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(Cl)c(-c4cnc5ccccc5n4)c3)cc2)CC(C)O1 |
| InChI | InChI=1S/C27H25ClN4O4S/c1-17-15-32(16-18(2)36-17)37(34,35)21-10-7-19(8-11-21)27(33)30-20-9-12-23(28)22(13-20)26-14-29-24-5-3-4-6-25(24)31-26/h3-14,17-18H,15-16H2,1-2H3,(H,30,33) |
| InChIKey | BCHGQTQCGHONBO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |