About 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine
2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine (PubChem CID 59826761) has the molecular formula C7H10N2O2S
and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine |
| PubChem CID | 59826761 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine |
| SMILES | [2H]C([2H])([2H])Oc1cc(OC([2H])([2H])[2H])nc(SC)n1 |
| InChI | InChI=1S/C7H10N2O2S/c1-10-5-4-6(11-2)9-7(8-5)12-3/h4H,1-3H3/i1D3,2D3 |
| InChIKey | URSYQIBBJXLQBW-WFGJKAKNSA-N |
| XLogP | 1.22 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine?
The IUPAC name of 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine (CID 59826761) is 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine.
What is the SMILES notation for 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine?
The canonical SMILES for 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine is [2H]C([2H])([2H])Oc1cc(OC([2H])([2H])[2H])nc(SC)n1.
What is the InChIKey of 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine?
The InChIKey is URSYQIBBJXLQBW-WFGJKAKNSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-10-5-4-6(11-2)9-7(8-5)12-3/h4H,1-3H3/i1D3,2D3.
What are the key properties of 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine?
2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine has a molecular weight of 192.27 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-4,6-bis(trideuteriomethoxy)pyrimidine is sourced from PubChem (CID 59826761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).