C17H13FI2OS — CID 59827006
(2R,6R)-17-fluoro-9-iodo-4-(iodomethyl)-3-oxa-13-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene (PubChem CID 59827006) has the molecular formula C17H13FI2OS and a molecular weight of 538.16 g/mol. Its IUPAC name is (2R,6R)-17-fluoro-9-iodo-4-(iodomethyl)-3-oxa-13-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene.
| Compound Name | (2R,6R)-17-fluoro-9-iodo-4-(iodomethyl)-3-oxa-13-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene |
|---|---|
| PubChem CID | 59827006 |
| Molecular Formula | C17H13FI2OS |
| Molecular Weight | 538.16 g/mol |
| Exact Mass | 537.88 |
| IUPAC Name | (2R,6R)-17-fluoro-9-iodo-4-(iodomethyl)-3-oxa-13-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene |
| SMILES | Fc1ccc2c(c1)[C@@H]1OC(CI)C[C@@H]1c1cc(I)ccc1S2 |
| InChI | InChI=1S/C17H13FI2OS/c18-9-1-3-16-14(5-9)17-13(7-11(8-19)21-17)12-6-10(20)2-4-15(12)22-16/h1-6,11,13,17H,7-8H2/t11?,13-,17-/m1/s1 |
| InChIKey | PWPDLVIQNDEMRQ-STQVRIHGSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.16 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|