C31H32ClFN2O3 — CID 59827029
(2-chlorophenyl)methyl N-[1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 59827029) has the molecular formula C31H32ClFN2O3 and a molecular weight of 535.06 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59827029 |
| Molecular Formula | C31H32ClFN2O3 |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (2-chlorophenyl)methyl N-[1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | O=C(NC1CCN(C[C@H]2C[C@@H]3c4ccccc4Cc4ccc(F)cc4[C@@H]3O2)CC1)OCc1ccccc1Cl |
| InChI | InChI=1S/C31H32ClFN2O3/c32-29-8-4-2-6-22(29)19-37-31(36)34-24-11-13-35(14-12-24)18-25-17-28-26-7-3-1-5-20(26)15-21-9-10-23(33)16-27(21)30(28)38-25/h1-10,16,24-25,28,30H,11-15,17-19H2,(H,34,36)/t25-,28-,30+/m1/s1 |
| InChIKey | IOQVVEICVHHGAH-CZMKHNCBSA-N |
| XLogP | 6.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |