C23H26FNO2 — CID 59827049
[1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]pyrrolidin-3-yl]methanol (PubChem CID 59827049) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is [1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 59827049 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [1-[[(2R,4R,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(C[C@H]2C[C@@H]3c4ccccc4Cc4ccc(F)cc4[C@@H]3O2)C1 |
| InChI | InChI=1S/C23H26FNO2/c24-18-6-5-17-9-16-3-1-2-4-20(16)22-11-19(27-23(22)21(17)10-18)13-25-8-7-15(12-25)14-26/h1-6,10,15,19,22-23,26H,7-9,11-14H2/t15?,19-,22-,23+/m1/s1 |
| InChIKey | GUYMGRVJNYYCOB-AFLMANCJSA-N |
| XLogP | 3.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |