C38H41N3S4 — CID 59827179
4-methyl-10-[5-[7-(5-methylthiophen-2-yl)spiro[benzimidazole-2,1'-cyclopentane]-4-yl]thiophen-2-yl]-7-nonyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 59827179) has the molecular formula C38H41N3S4 and a molecular weight of 668.04 g/mol. Its IUPAC name is 4-methyl-10-[5-[7-(5-methylthiophen-2-yl)spiro[benzimidazole-2,1'-cyclopentane]-4-yl]thiophen-2-yl]-7-nonyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4-methyl-10-[5-[7-(5-methylthiophen-2-yl)spiro[benzimidazole-2,1'-cyclopentane]-4-yl]thiophen-2-yl]-7-nonyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 59827179 |
| Molecular Formula | C38H41N3S4 |
| Molecular Weight | 668.04 g/mol |
| Exact Mass | 667.22 |
| IUPAC Name | 4-methyl-10-[5-[7-(5-methylthiophen-2-yl)spiro[benzimidazole-2,1'-cyclopentane]-4-yl]thiophen-2-yl]-7-nonyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCCCCn1c2cc(C)sc2c2sc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5c4=NC4(CCCC4)N=5)s3)cc21 |
| InChI | InChI=1S/C38H41N3S4/c1-4-5-6-7-8-9-12-21-41-28-22-25(3)43-36(28)37-29(41)23-33(45-37)32-18-17-31(44-32)27-15-14-26(30-16-13-24(2)42-30)34-35(27)40-38(39-34)19-10-11-20-38/h13-18,22-23H,4-12,19-21H2,1-3H3 |
| InChIKey | SPVWLXIBRDNSSX-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.04 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|