C16H32FNO2 — CID 59827431
(E,2S,3R)-2-(dimethylamino)-14-fluorotetradec-6-ene-1,3-diol (PubChem CID 59827431) has the molecular formula C16H32FNO2 and a molecular weight of 289.44 g/mol. Its IUPAC name is (E,2S,3R)-2-(dimethylamino)-14-fluorotetradec-6-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-(dimethylamino)-14-fluorotetradec-6-ene-1,3-diol |
|---|---|
| PubChem CID | 59827431 |
| Molecular Formula | C16H32FNO2 |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (E,2S,3R)-2-(dimethylamino)-14-fluorotetradec-6-ene-1,3-diol |
| SMILES | CN(C)[C@@H](CO)[C@H](O)CC/C=C/CCCCCCCF |
| InChI | InChI=1S/C16H32FNO2/c1-18(2)15(14-19)16(20)12-10-8-6-4-3-5-7-9-11-13-17/h6,8,15-16,19-20H,3-5,7,9-14H2,1-2H3/b8-6+/t15-,16+/m0/s1 |
| InChIKey | DWNPRPWBCPPIHO-BWVNKGDMSA-N |
| XLogP | 2.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|