C36H58N2 — CID 59827492
1-N,2-N,4,5-tetramethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 59827492) has the molecular formula C36H58N2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 1-N,2-N,4,5-tetramethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,4,5-tetramethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 59827492 |
| Molecular Formula | C36H58N2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.46 |
| IUPAC Name | 1-N,2-N,4,5-tetramethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCC(/C=C(\C)C1=C(C)C(C)=C(/C(C)=C/C(CCCCCC)=C(C)C)C(=N/C)/C1=N\C)=C(C)C |
| InChI | InChI=1S/C36H58N2/c1-13-15-17-19-21-31(25(3)4)23-27(7)33-29(9)30(10)34(36(38-12)35(33)37-11)28(8)24-32(26(5)6)22-20-18-16-14-2/h23-24H,13-22H2,1-12H3/b27-23+,28-24+,37-35-,38-36- |
| InChIKey | BOQGLQKEYNPHAS-DZTDNXMQSA-N |
| XLogP | 11.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|