About 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one
1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one (PubChem CID 59827762) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one.
Molecular Properties
| Compound Name | 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one |
| PubChem CID | 59827762 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one |
| SMILES | CCN1CC2(CC3CCC(C2)N3)N(CC)C1=O |
| InChI | InChI=1S/C13H23N3O/c1-3-15-9-13(16(4-2)12(15)17)7-10-5-6-11(8-13)14-10/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | PLALSXDGSNZVNN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one?
The IUPAC name of 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one (CID 59827762) is 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one.
What is the SMILES notation for 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one?
The canonical SMILES for 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one is CCN1CC2(CC3CCC(C2)N3)N(CC)C1=O.
What is the InChIKey of 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one?
The InChIKey is PLALSXDGSNZVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-3-15-9-13(16(4-2)12(15)17)7-10-5-6-11(8-13)14-10/h10-11,14H,3-9H2,1-2H3.
What are the key properties of 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one?
1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one has a molecular weight of 237.35 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1',3'-diethylspiro[8-azabicyclo[3.2.1]octane-3,4'-imidazolidine]-2'-one is sourced from PubChem (CID 59827762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).