C22H24N2O2 — CID 59827878
(1R,15E,22R)-12-oxa-8,18-diazaheptacyclo[16.5.2.01,19.02,7.08,23.011,22.016,21]pentacosa-2,4,6,15-tetraen-9-one (PubChem CID 59827878) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (1R,15E,22R)-12-oxa-8,18-diazaheptacyclo[16.5.2.01,19.02,7.08,23.011,22.016,21]pentacosa-2,4,6,15-tetraen-9-one.
| Compound Name | (1R,15E,22R)-12-oxa-8,18-diazaheptacyclo[16.5.2.01,19.02,7.08,23.011,22.016,21]pentacosa-2,4,6,15-tetraen-9-one |
|---|---|
| PubChem CID | 59827878 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (1R,15E,22R)-12-oxa-8,18-diazaheptacyclo[16.5.2.01,19.02,7.08,23.011,22.016,21]pentacosa-2,4,6,15-tetraen-9-one |
| SMILES | O=C1CC2OCC/C=C3/CN4CC[C@]56c7ccccc7N1C5[C@H]2C3CC46 |
| InChI | InChI=1S/C22H24N2O2/c25-19-11-17-20-14-10-18-22(7-8-23(18)12-13(14)4-3-9-26-17)15-5-1-2-6-16(15)24(19)21(20)22/h1-2,4-6,14,17-18,20-21H,3,7-12H2/b13-4-/t14?,17?,18?,20-,21?,22+/m0/s1 |
| InChIKey | JZPQUTFYCZLWNT-SJUSOIMVSA-N |
| XLogP | 2.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|