C37H31N5O2 — CID 59827900
2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyridin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione (PubChem CID 59827900) has the molecular formula C37H31N5O2 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyridin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyridin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59827900 |
| Molecular Formula | C37H31N5O2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyridin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
| SMILES | Nc1cccn2c(C3CCC(CN4C(=O)c5ccccc5C4=O)CC3)nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C37H31N5O2/c38-30-11-6-20-41-34(30)33(27-17-16-25-18-19-31(39-32(25)21-27)24-7-2-1-3-8-24)40-35(41)26-14-12-23(13-15-26)22-42-36(43)28-9-4-5-10-29(28)37(42)44/h1-11,16-21,23,26H,12-15,22,38H2 |
| InChIKey | LJLBDDAKTPJKGL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|