C9H19NO3 — CID 59828172
(2S,3R,5R)-5-amino-6-methyl-2-propan-2-yloxane-3,4-diol (PubChem CID 59828172) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (2S,3R,5R)-5-amino-6-methyl-2-propan-2-yloxane-3,4-diol.
| Compound Name | (2S,3R,5R)-5-amino-6-methyl-2-propan-2-yloxane-3,4-diol |
|---|---|
| PubChem CID | 59828172 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (2S,3R,5R)-5-amino-6-methyl-2-propan-2-yloxane-3,4-diol |
| SMILES | CC1O[C@@H](C(C)C)[C@H](O)C(O)[C@H]1N |
| InChI | InChI=1S/C9H19NO3/c1-4(2)9-8(12)7(11)6(10)5(3)13-9/h4-9,11-12H,10H2,1-3H3/t5?,6-,7?,8+,9-/m0/s1 |
| InChIKey | HBFWELSWTNPDAO-BCUULUNSSA-N |
| XLogP | -0.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |